C13H25F3N2 — CID 79051089
2-(azepan-1-yl)-6,6,6-trifluoro-2-methylhexan-3-amine (PubChem CID 79051089) has the molecular formula C13H25F3N2 and a molecular weight of 266.35 g/mol. Its IUPAC name is 2-(azepan-1-yl)-6,6,6-trifluoro-2-methylhexan-3-amine.
| Compound Name | 2-(azepan-1-yl)-6,6,6-trifluoro-2-methylhexan-3-amine |
|---|---|
| PubChem CID | 79051089 |
| Molecular Formula | C13H25F3N2 |
| Molecular Weight | 266.35 g/mol |
| Exact Mass | 266.20 |
| IUPAC Name | 2-(azepan-1-yl)-6,6,6-trifluoro-2-methylhexan-3-amine |
| SMILES | CC(C)(C(N)CCC(F)(F)F)N1CCCCCC1 |
| InChI | InChI=1S/C13H25F3N2/c1-12(2,11(17)7-8-13(14,15)16)18-9-5-3-4-6-10-18/h11H,3-10,17H2,1-2H3 |
| InChIKey | BKOHXZQNLKMBJU-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.35 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |