C16H27ClN2 — CID 79061666
1-(2-chlorophenyl)-2-N,2-N,2-triethylbutane-1,2-diamine (PubChem CID 79061666) has the molecular formula C16H27ClN2 and a molecular weight of 282.86 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-2-N,2-N,2-triethylbutane-1,2-diamine.
| Compound Name | 1-(2-chlorophenyl)-2-N,2-N,2-triethylbutane-1,2-diamine |
|---|---|
| PubChem CID | 79061666 |
| Molecular Formula | C16H27ClN2 |
| Molecular Weight | 282.86 g/mol |
| Exact Mass | 282.19 |
| IUPAC Name | 1-(2-chlorophenyl)-2-N,2-N,2-triethylbutane-1,2-diamine |
| SMILES | CCN(CC)C(CC)(CC)C(N)c1ccccc1Cl |
| InChI | InChI=1S/C16H27ClN2/c1-5-16(6-2,19(7-3)8-4)15(18)13-11-9-10-12-14(13)17/h9-12,15H,5-8,18H2,1-4H3 |
| InChIKey | BYBCRARGWVWVPX-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.86 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |