C16H26F2N2 — CID 79062206
1-(2,5-difluorophenyl)-2-N,2-N,2-triethylbutane-1,2-diamine (PubChem CID 79062206) has the molecular formula C16H26F2N2 and a molecular weight of 284.39 g/mol. Its IUPAC name is 1-(2,5-difluorophenyl)-2-N,2-N,2-triethylbutane-1,2-diamine.
| Compound Name | 1-(2,5-difluorophenyl)-2-N,2-N,2-triethylbutane-1,2-diamine |
|---|---|
| PubChem CID | 79062206 |
| Molecular Formula | C16H26F2N2 |
| Molecular Weight | 284.39 g/mol |
| Exact Mass | 284.21 |
| IUPAC Name | 1-(2,5-difluorophenyl)-2-N,2-N,2-triethylbutane-1,2-diamine |
| SMILES | CCN(CC)C(CC)(CC)C(N)c1cc(F)ccc1F |
| InChI | InChI=1S/C16H26F2N2/c1-5-16(6-2,20(7-3)8-4)15(19)13-11-12(17)9-10-14(13)18/h9-11,15H,5-8,19H2,1-4H3 |
| InChIKey | BRNNYCATQOKHHH-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.39 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |