C16H28N2S — CID 79065597
N,3-dimethyl-3-piperidin-1-yl-1-thiophen-2-ylpentan-2-amine (PubChem CID 79065597) has the molecular formula C16H28N2S and a molecular weight of 280.48 g/mol. Its IUPAC name is N,3-dimethyl-3-piperidin-1-yl-1-thiophen-2-ylpentan-2-amine.
| Compound Name | N,3-dimethyl-3-piperidin-1-yl-1-thiophen-2-ylpentan-2-amine |
|---|---|
| PubChem CID | 79065597 |
| Molecular Formula | C16H28N2S |
| Molecular Weight | 280.48 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | N,3-dimethyl-3-piperidin-1-yl-1-thiophen-2-ylpentan-2-amine |
| SMILES | CCC(C)(C(Cc1cccs1)NC)N1CCCCC1 |
| InChI | InChI=1S/C16H28N2S/c1-4-16(2,18-10-6-5-7-11-18)15(17-3)13-14-9-8-12-19-14/h8-9,12,15,17H,4-7,10-11,13H2,1-3H3 |
| InChIKey | JVEHTRHPIKKGQH-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.48 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |