C13H18N2S — CID 82083214
2-methyl-2-piperidin-1-yl-3-thiophen-2-ylpropanenitrile (PubChem CID 82083214) has the molecular formula C13H18N2S and a molecular weight of 234.37 g/mol. Its IUPAC name is 2-methyl-2-piperidin-1-yl-3-thiophen-2-ylpropanenitrile.
| Compound Name | 2-methyl-2-piperidin-1-yl-3-thiophen-2-ylpropanenitrile |
|---|---|
| PubChem CID | 82083214 |
| Molecular Formula | C13H18N2S |
| Molecular Weight | 234.37 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | 2-methyl-2-piperidin-1-yl-3-thiophen-2-ylpropanenitrile |
| SMILES | CC(C#N)(Cc1cccs1)N1CCCCC1 |
| InChI | InChI=1S/C13H18N2S/c1-13(11-14,10-12-6-5-9-16-12)15-7-3-2-4-8-15/h5-6,9H,2-4,7-8,10H2,1H3 |
| InChIKey | ZJMCGLDLDCFBTM-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.37 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |