C17H21N3 — CID 84751976
3-(1H-indol-3-yl)-2-methyl-2-piperidin-1-ylpropanenitrile (PubChem CID 84751976) has the molecular formula C17H21N3 and a molecular weight of 267.38 g/mol. Its IUPAC name is 3-(1H-indol-3-yl)-2-methyl-2-piperidin-1-ylpropanenitrile.
| Compound Name | 3-(1H-indol-3-yl)-2-methyl-2-piperidin-1-ylpropanenitrile |
|---|---|
| PubChem CID | 84751976 |
| Molecular Formula | C17H21N3 |
| Molecular Weight | 267.38 g/mol |
| Exact Mass | 267.17 |
| IUPAC Name | 3-(1H-indol-3-yl)-2-methyl-2-piperidin-1-ylpropanenitrile |
| SMILES | CC(C#N)(Cc1c[nH]c2ccccc12)N1CCCCC1 |
| InChI | InChI=1S/C17H21N3/c1-17(13-18,20-9-5-2-6-10-20)11-14-12-19-16-8-4-3-7-15(14)16/h3-4,7-8,12,19H,2,5-6,9-11H2,1H3 |
| InChIKey | BIZCKBHSWGGPJN-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 42.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.38 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |