About 2-[2-(4-methylmorpholin-2-yl)-1,3-thiazol-4-yl]acetic acid
2-[2-(4-methylmorpholin-2-yl)-1,3-thiazol-4-yl]acetic acid (PubChem CID 79078482) has the molecular formula C10H14N2O3S
and a molecular weight of 242.30 g/mol. Its IUPAC name is 2-[2-(4-methylmorpholin-2-yl)-1,3-thiazol-4-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[2-(4-methylmorpholin-2-yl)-1,3-thiazol-4-yl]acetic acid |
| PubChem CID | 79078482 |
| Molecular Formula | C10H14N2O3S |
| Molecular Weight | 242.30 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | 2-[2-(4-methylmorpholin-2-yl)-1,3-thiazol-4-yl]acetic acid |
| SMILES | CN1CCOC(c2nc(CC(=O)O)cs2)C1 |
| InChI | InChI=1S/C10H14N2O3S/c1-12-2-3-15-8(5-12)10-11-7(6-16-10)4-9(13)14/h6,8H,2-5H2,1H3,(H,13,14) |
| InChIKey | MOTFMXJSHYNSBW-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.30 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[2-(4-methylmorpholin-2-yl)-1,3-thiazol-4-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(4-methylmorpholin-2-yl)-1,3-thiazol-4-yl]acetic acid?
The IUPAC name of 2-[2-(4-methylmorpholin-2-yl)-1,3-thiazol-4-yl]acetic acid (CID 79078482) is 2-[2-(4-methylmorpholin-2-yl)-1,3-thiazol-4-yl]acetic acid.
What is the SMILES notation for 2-[2-(4-methylmorpholin-2-yl)-1,3-thiazol-4-yl]acetic acid?
The canonical SMILES for 2-[2-(4-methylmorpholin-2-yl)-1,3-thiazol-4-yl]acetic acid is CN1CCOC(c2nc(CC(=O)O)cs2)C1.
What is the InChIKey of 2-[2-(4-methylmorpholin-2-yl)-1,3-thiazol-4-yl]acetic acid?
The InChIKey is MOTFMXJSHYNSBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2O3S/c1-12-2-3-15-8(5-12)10-11-7(6-16-10)4-9(13)14/h6,8H,2-5H2,1H3,(H,13,14).
What are the key properties of 2-[2-(4-methylmorpholin-2-yl)-1,3-thiazol-4-yl]acetic acid?
2-[2-(4-methylmorpholin-2-yl)-1,3-thiazol-4-yl]acetic acid has a molecular weight of 242.30 g/mol, XLogP of 0.77, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(4-methylmorpholin-2-yl)-1,3-thiazol-4-yl]acetic acid is sourced from PubChem (CID 79078482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).