C18H22N2O3S — CID 99843497
methyl 3-[2-[(2S)-4-benzylmorpholin-2-yl]-1,3-thiazol-4-yl]propanoate (PubChem CID 99843497) has the molecular formula C18H22N2O3S and a molecular weight of 346.45 g/mol. Its IUPAC name is methyl 3-[2-[(2S)-4-benzylmorpholin-2-yl]-1,3-thiazol-4-yl]propanoate.
| Compound Name | methyl 3-[2-[(2S)-4-benzylmorpholin-2-yl]-1,3-thiazol-4-yl]propanoate |
|---|---|
| PubChem CID | 99843497 |
| Molecular Formula | C18H22N2O3S |
| Molecular Weight | 346.45 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | methyl 3-[2-[(2S)-4-benzylmorpholin-2-yl]-1,3-thiazol-4-yl]propanoate |
| SMILES | COC(=O)CCc1csc([C@@H]2CN(Cc3ccccc3)CCO2)n1 |
| InChI | InChI=1S/C18H22N2O3S/c1-22-17(21)8-7-15-13-24-18(19-15)16-12-20(9-10-23-16)11-14-5-3-2-4-6-14/h2-6,13,16H,7-12H2,1H3/t16-/m0/s1 |
| InChIKey | FSJQIMGDSXHSHZ-INIZCTEOSA-N |
| XLogP | 2.82 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.45 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |