5-[1-(1,4-thiazepan-4-yl)ethyl]furan-2-carboxylic acid

C12H17NO3S — CID 79083657

IUPAC5-[1-(1,4-thiazepan-4-yl)ethyl]furan-2-carboxylic acid
SMILESCC(c1ccc(C(=O)O)o1)N1CCCSCC1
InChIInChI=1S/C12H17NO3S/c1-9(13-5-2-7-17-8-6-13)10-3-4-11(16-10)12(14)15/h3-4,9H,2,5-8H2,1H3,(H,14,15)
InChIKeyGHSCDKRFABKEFP-UHFFFAOYSA-N
MW255.34 g/mol
LogP2.48
Rot. Bonds3

About 5-[1-(1,4-thiazepan-4-yl)ethyl]furan-2-carboxylic acid

5-[1-(1,4-thiazepan-4-yl)ethyl]furan-2-carboxylic acid (PubChem CID 79083657) has the molecular formula C12H17NO3S and a molecular weight of 255.34 g/mol. Its IUPAC name is 5-[1-(1,4-thiazepan-4-yl)ethyl]furan-2-carboxylic acid.

Molecular Properties

Compound Name5-[1-(1,4-thiazepan-4-yl)ethyl]furan-2-carboxylic acid
PubChem CID79083657
Molecular FormulaC12H17NO3S
Molecular Weight255.34 g/mol
Exact Mass255.09
IUPAC Name5-[1-(1,4-thiazepan-4-yl)ethyl]furan-2-carboxylic acid
SMILESCC(c1ccc(C(=O)O)o1)N1CCCSCC1
InChIInChI=1S/C12H17NO3S/c1-9(13-5-2-7-17-8-6-13)10-3-4-11(16-10)12(14)15/h3-4,9H,2,5-8H2,1H3,(H,14,15)
InChIKeyGHSCDKRFABKEFP-UHFFFAOYSA-N
XLogP2.48
TPSA53.68 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500255.34
LogP ≤ 52.48
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 5-[1-(1,4-thiazepan-4-yl)ethyl]furan-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-[1-(1,4-thiazepan-4-yl)ethyl]furan-2-carboxylic acid?
The IUPAC name of 5-[1-(1,4-thiazepan-4-yl)ethyl]furan-2-carboxylic acid (CID 79083657) is 5-[1-(1,4-thiazepan-4-yl)ethyl]furan-2-carboxylic acid.
What is the SMILES notation for 5-[1-(1,4-thiazepan-4-yl)ethyl]furan-2-carboxylic acid?
The canonical SMILES for 5-[1-(1,4-thiazepan-4-yl)ethyl]furan-2-carboxylic acid is CC(c1ccc(C(=O)O)o1)N1CCCSCC1.
What is the InChIKey of 5-[1-(1,4-thiazepan-4-yl)ethyl]furan-2-carboxylic acid?
The InChIKey is GHSCDKRFABKEFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO3S/c1-9(13-5-2-7-17-8-6-13)10-3-4-11(16-10)12(14)15/h3-4,9H,2,5-8H2,1H3,(H,14,15).
What are the key properties of 5-[1-(1,4-thiazepan-4-yl)ethyl]furan-2-carboxylic acid?
5-[1-(1,4-thiazepan-4-yl)ethyl]furan-2-carboxylic acid has a molecular weight of 255.34 g/mol, XLogP of 2.48, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[1-(1,4-thiazepan-4-yl)ethyl]furan-2-carboxylic acid is sourced from PubChem (CID 79083657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).