C14H16F2N2 — CID 79089751
N-[1-(2,6-difluorophenyl)ethyl]-2,5-dimethylpyrrol-1-amine (PubChem CID 79089751) has the molecular formula C14H16F2N2 and a molecular weight of 250.29 g/mol. Its IUPAC name is N-[1-(2,6-difluorophenyl)ethyl]-2,5-dimethylpyrrol-1-amine.
| Compound Name | N-[1-(2,6-difluorophenyl)ethyl]-2,5-dimethylpyrrol-1-amine |
|---|---|
| PubChem CID | 79089751 |
| Molecular Formula | C14H16F2N2 |
| Molecular Weight | 250.29 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | N-[1-(2,6-difluorophenyl)ethyl]-2,5-dimethylpyrrol-1-amine |
| SMILES | Cc1ccc(C)n1NC(C)c1c(F)cccc1F |
| InChI | InChI=1S/C14H16F2N2/c1-9-7-8-10(2)18(9)17-11(3)14-12(15)5-4-6-13(14)16/h4-8,11,17H,1-3H3 |
| InChIKey | CFBVZWDYERAKRE-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.29 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |