C13H20N2O4 — CID 79090150
5-[1-[ethyl-[2-(ethylamino)-2-oxoethyl]amino]ethyl]furan-2-carboxylic acid (PubChem CID 79090150) has the molecular formula C13H20N2O4 and a molecular weight of 268.31 g/mol. Its IUPAC name is 5-[1-[ethyl-[2-(ethylamino)-2-oxoethyl]amino]ethyl]furan-2-carboxylic acid.
| Compound Name | 5-[1-[ethyl-[2-(ethylamino)-2-oxoethyl]amino]ethyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 79090150 |
| Molecular Formula | C13H20N2O4 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | 5-[1-[ethyl-[2-(ethylamino)-2-oxoethyl]amino]ethyl]furan-2-carboxylic acid |
| SMILES | CCNC(=O)CN(CC)C(C)c1ccc(C(=O)O)o1 |
| InChI | InChI=1S/C13H20N2O4/c1-4-14-12(16)8-15(5-2)9(3)10-6-7-11(19-10)13(17)18/h6-7,9H,4-5,8H2,1-3H3,(H,14,16)(H,17,18) |
| InChIKey | FJPUQSGKNPFIQF-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 82.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |