About 5-[(2,5-dimethylpyrrol-1-yl)sulfamoyl]thiophene-2-carboxylic acid
5-[(2,5-dimethylpyrrol-1-yl)sulfamoyl]thiophene-2-carboxylic acid (PubChem CID 79090371) has the molecular formula C11H12N2O4S2
and a molecular weight of 300.36 g/mol. Its IUPAC name is 5-[(2,5-dimethylpyrrol-1-yl)sulfamoyl]thiophene-2-carboxylic acid.
Molecular Properties
| Compound Name | 5-[(2,5-dimethylpyrrol-1-yl)sulfamoyl]thiophene-2-carboxylic acid |
| PubChem CID | 79090371 |
| Molecular Formula | C11H12N2O4S2 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.02 |
| IUPAC Name | 5-[(2,5-dimethylpyrrol-1-yl)sulfamoyl]thiophene-2-carboxylic acid |
| SMILES | Cc1ccc(C)n1NS(=O)(=O)c1ccc(C(=O)O)s1 |
| InChI | InChI=1S/C11H12N2O4S2/c1-7-3-4-8(2)13(7)12-19(16,17)10-6-5-9(18-10)11(14)15/h3-6,12H,1-2H3,(H,14,15) |
| InChIKey | BGSDJSIMMXSGRU-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 88.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[(2,5-dimethylpyrrol-1-yl)sulfamoyl]thiophene-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(2,5-dimethylpyrrol-1-yl)sulfamoyl]thiophene-2-carboxylic acid?
The IUPAC name of 5-[(2,5-dimethylpyrrol-1-yl)sulfamoyl]thiophene-2-carboxylic acid (CID 79090371) is 5-[(2,5-dimethylpyrrol-1-yl)sulfamoyl]thiophene-2-carboxylic acid.
What is the SMILES notation for 5-[(2,5-dimethylpyrrol-1-yl)sulfamoyl]thiophene-2-carboxylic acid?
The canonical SMILES for 5-[(2,5-dimethylpyrrol-1-yl)sulfamoyl]thiophene-2-carboxylic acid is Cc1ccc(C)n1NS(=O)(=O)c1ccc(C(=O)O)s1.
What is the InChIKey of 5-[(2,5-dimethylpyrrol-1-yl)sulfamoyl]thiophene-2-carboxylic acid?
The InChIKey is BGSDJSIMMXSGRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2O4S2/c1-7-3-4-8(2)13(7)12-19(16,17)10-6-5-9(18-10)11(14)15/h3-6,12H,1-2H3,(H,14,15).
What are the key properties of 5-[(2,5-dimethylpyrrol-1-yl)sulfamoyl]thiophene-2-carboxylic acid?
5-[(2,5-dimethylpyrrol-1-yl)sulfamoyl]thiophene-2-carboxylic acid has a molecular weight of 300.36 g/mol, XLogP of 1.80, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(2,5-dimethylpyrrol-1-yl)sulfamoyl]thiophene-2-carboxylic acid is sourced from PubChem (CID 79090371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).