C14H17ClN2 — CID 79100478
N-[1-(3-chlorophenyl)ethyl]-2,5-dimethylpyrrol-1-amine (PubChem CID 79100478) has the molecular formula C14H17ClN2 and a molecular weight of 248.76 g/mol. Its IUPAC name is N-[1-(3-chlorophenyl)ethyl]-2,5-dimethylpyrrol-1-amine.
| Compound Name | N-[1-(3-chlorophenyl)ethyl]-2,5-dimethylpyrrol-1-amine |
|---|---|
| PubChem CID | 79100478 |
| Molecular Formula | C14H17ClN2 |
| Molecular Weight | 248.76 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | N-[1-(3-chlorophenyl)ethyl]-2,5-dimethylpyrrol-1-amine |
| SMILES | Cc1ccc(C)n1NC(C)c1cccc(Cl)c1 |
| InChI | InChI=1S/C14H17ClN2/c1-10-7-8-11(2)17(10)16-12(3)13-5-4-6-14(15)9-13/h4-9,12,16H,1-3H3 |
| InChIKey | XFVQFSOUMXJVDE-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.76 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |