C11H13ClN2S — CID 79102325
1-[1-[(5-chlorothiophen-2-yl)methyl]pyrrol-2-yl]ethanamine (PubChem CID 79102325) has the molecular formula C11H13ClN2S and a molecular weight of 240.76 g/mol. Its IUPAC name is 1-[1-[(5-chlorothiophen-2-yl)methyl]pyrrol-2-yl]ethanamine.
| Compound Name | 1-[1-[(5-chlorothiophen-2-yl)methyl]pyrrol-2-yl]ethanamine |
|---|---|
| PubChem CID | 79102325 |
| Molecular Formula | C11H13ClN2S |
| Molecular Weight | 240.76 g/mol |
| Exact Mass | 240.05 |
| IUPAC Name | 1-[1-[(5-chlorothiophen-2-yl)methyl]pyrrol-2-yl]ethanamine |
| SMILES | CC(N)c1cccn1Cc1ccc(Cl)s1 |
| InChI | InChI=1S/C11H13ClN2S/c1-8(13)10-3-2-6-14(10)7-9-4-5-11(12)15-9/h2-6,8H,7,13H2,1H3 |
| InChIKey | OHUUAZHUHMVIBT-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.76 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |