C18H32N2 — CID 79113300
4-N-(1-adamantylmethyl)-4-N-methylcyclohexane-1,4-diamine (PubChem CID 79113300) has the molecular formula C18H32N2 and a molecular weight of 276.47 g/mol. Its IUPAC name is 4-N-(1-adamantylmethyl)-4-N-methylcyclohexane-1,4-diamine.
| Compound Name | 4-N-(1-adamantylmethyl)-4-N-methylcyclohexane-1,4-diamine |
|---|---|
| PubChem CID | 79113300 |
| Molecular Formula | C18H32N2 |
| Molecular Weight | 276.47 g/mol |
| Exact Mass | 276.26 |
| IUPAC Name | 4-N-(1-adamantylmethyl)-4-N-methylcyclohexane-1,4-diamine |
| SMILES | CN(CC12CC3CC(CC(C3)C1)C2)C1CCC(N)CC1 |
| InChI | InChI=1S/C18H32N2/c1-20(17-4-2-16(19)3-5-17)12-18-9-13-6-14(10-18)8-15(7-13)11-18/h13-17H,2-12,19H2,1H3 |
| InChIKey | DBBXNIFWKNUIPE-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.47 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |