C14H24N2O2S2 — CID 79115688
N-(4-aminocyclohexyl)-N,5-diethylthiophene-2-sulfonamide (PubChem CID 79115688) has the molecular formula C14H24N2O2S2 and a molecular weight of 316.49 g/mol. Its IUPAC name is N-(4-aminocyclohexyl)-N,5-diethylthiophene-2-sulfonamide.
| Compound Name | N-(4-aminocyclohexyl)-N,5-diethylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 79115688 |
| Molecular Formula | C14H24N2O2S2 |
| Molecular Weight | 316.49 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | N-(4-aminocyclohexyl)-N,5-diethylthiophene-2-sulfonamide |
| SMILES | CCc1ccc(S(=O)(=O)N(CC)C2CCC(N)CC2)s1 |
| InChI | InChI=1S/C14H24N2O2S2/c1-3-13-9-10-14(19-13)20(17,18)16(4-2)12-7-5-11(15)6-8-12/h9-12H,3-8,15H2,1-2H3 |
| InChIKey | VIMPORMFUBXYOI-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.49 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |