C16H18FNO2S2 — CID 55904602
N-cyclopropyl-5-ethyl-N-[(2-fluorophenyl)methyl]thiophene-2-sulfonamide (PubChem CID 55904602) has the molecular formula C16H18FNO2S2 and a molecular weight of 339.46 g/mol. Its IUPAC name is N-cyclopropyl-5-ethyl-N-[(2-fluorophenyl)methyl]thiophene-2-sulfonamide.
| Compound Name | N-cyclopropyl-5-ethyl-N-[(2-fluorophenyl)methyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 55904602 |
| Molecular Formula | C16H18FNO2S2 |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.08 |
| IUPAC Name | N-cyclopropyl-5-ethyl-N-[(2-fluorophenyl)methyl]thiophene-2-sulfonamide |
| SMILES | CCc1ccc(S(=O)(=O)N(Cc2ccccc2F)C2CC2)s1 |
| InChI | InChI=1S/C16H18FNO2S2/c1-2-14-9-10-16(21-14)22(19,20)18(13-7-8-13)11-12-5-3-4-6-15(12)17/h3-6,9-10,13H,2,7-8,11H2,1H3 |
| InChIKey | JRFUBARLWKHYTB-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |