C17H23NO3 — CID 79118080
N-(1,4-dioxaspiro[4.5]decan-8-yl)-N,2-dimethylbenzamide (PubChem CID 79118080) has the molecular formula C17H23NO3 and a molecular weight of 289.37 g/mol. Its IUPAC name is N-(1,4-dioxaspiro[4.5]decan-8-yl)-N,2-dimethylbenzamide.
| Compound Name | N-(1,4-dioxaspiro[4.5]decan-8-yl)-N,2-dimethylbenzamide |
|---|---|
| PubChem CID | 79118080 |
| Molecular Formula | C17H23NO3 |
| Molecular Weight | 289.37 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | N-(1,4-dioxaspiro[4.5]decan-8-yl)-N,2-dimethylbenzamide |
| SMILES | Cc1ccccc1C(=O)N(C)C1CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C17H23NO3/c1-13-5-3-4-6-15(13)16(19)18(2)14-7-9-17(10-8-14)20-11-12-21-17/h3-6,14H,7-12H2,1-2H3 |
| InChIKey | DTGZKXSZIMFWJI-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.37 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |