C22H22ClN3O3 — CID 7911899
2-chloro-N-[3-[(E)-2-cyano-3-(3-ethoxypropylamino)-3-oxoprop-1-enyl]phenyl]benzamide (PubChem CID 7911899) has the molecular formula C22H22ClN3O3 and a molecular weight of 411.89 g/mol. Its IUPAC name is 2-chloro-N-[3-[(E)-2-cyano-3-(3-ethoxypropylamino)-3-oxoprop-1-enyl]phenyl]benzamide.
| Compound Name | 2-chloro-N-[3-[(E)-2-cyano-3-(3-ethoxypropylamino)-3-oxoprop-1-enyl]phenyl]benzamide |
|---|---|
| PubChem CID | 7911899 |
| Molecular Formula | C22H22ClN3O3 |
| Molecular Weight | 411.89 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | 2-chloro-N-[3-[(E)-2-cyano-3-(3-ethoxypropylamino)-3-oxoprop-1-enyl]phenyl]benzamide |
| SMILES | CCOCCCNC(=O)/C(C#N)=C/c1cccc(NC(=O)c2ccccc2Cl)c1 |
| InChI | InChI=1S/C22H22ClN3O3/c1-2-29-12-6-11-25-21(27)17(15-24)13-16-7-5-8-18(14-16)26-22(28)19-9-3-4-10-20(19)23/h3-5,7-10,13-14H,2,6,11-12H2,1H3,(H,25,27)(H,26,28)/b17-13+ |
| InChIKey | NTFRWLUSGFIRBA-GHRIWEEISA-N |
| XLogP | 4.04 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.89 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|