C11H16N2OS — CID 79120259
4-[methyl(1,3-thiazol-4-ylmethyl)amino]cyclohexan-1-one (PubChem CID 79120259) has the molecular formula C11H16N2OS and a molecular weight of 224.33 g/mol. Its IUPAC name is 4-[methyl(1,3-thiazol-4-ylmethyl)amino]cyclohexan-1-one.
| Compound Name | 4-[methyl(1,3-thiazol-4-ylmethyl)amino]cyclohexan-1-one |
|---|---|
| PubChem CID | 79120259 |
| Molecular Formula | C11H16N2OS |
| Molecular Weight | 224.33 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | 4-[methyl(1,3-thiazol-4-ylmethyl)amino]cyclohexan-1-one |
| SMILES | CN(Cc1cscn1)C1CCC(=O)CC1 |
| InChI | InChI=1S/C11H16N2OS/c1-13(6-9-7-15-8-12-9)10-2-4-11(14)5-3-10/h7-8,10H,2-6H2,1H3 |
| InChIKey | NWESUUIOZGGWQH-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.33 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |