C10H21NO3 — CID 79123314
1-[1-(aminomethyl)cyclopentyl]-2,2-dimethoxyethanol (PubChem CID 79123314) has the molecular formula C10H21NO3 and a molecular weight of 203.28 g/mol. Its IUPAC name is 1-[1-(aminomethyl)cyclopentyl]-2,2-dimethoxyethanol.
| Compound Name | 1-[1-(aminomethyl)cyclopentyl]-2,2-dimethoxyethanol |
|---|---|
| PubChem CID | 79123314 |
| Molecular Formula | C10H21NO3 |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.15 |
| IUPAC Name | 1-[1-(aminomethyl)cyclopentyl]-2,2-dimethoxyethanol |
| SMILES | COC(OC)C(O)C1(CN)CCCC1 |
| InChI | InChI=1S/C10H21NO3/c1-13-9(14-2)8(12)10(7-11)5-3-4-6-10/h8-9,12H,3-7,11H2,1-2H3 |
| InChIKey | BZSILIOJSXCKPC-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|