C16H28F3NO — CID 79126064
1-[1-(aminomethyl)-4-ethylcyclohexyl]-3-(trifluoromethyl)cyclohexan-1-ol (PubChem CID 79126064) has the molecular formula C16H28F3NO and a molecular weight of 307.40 g/mol. Its IUPAC name is 1-[1-(aminomethyl)-4-ethylcyclohexyl]-3-(trifluoromethyl)cyclohexan-1-ol.
| Compound Name | 1-[1-(aminomethyl)-4-ethylcyclohexyl]-3-(trifluoromethyl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 79126064 |
| Molecular Formula | C16H28F3NO |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.21 |
| IUPAC Name | 1-[1-(aminomethyl)-4-ethylcyclohexyl]-3-(trifluoromethyl)cyclohexan-1-ol |
| SMILES | CCC1CCC(CN)(C2(O)CCCC(C(F)(F)F)C2)CC1 |
| InChI | InChI=1S/C16H28F3NO/c1-2-12-5-8-14(11-20,9-6-12)15(21)7-3-4-13(10-15)16(17,18)19/h12-13,21H,2-11,20H2,1H3 |
| InChIKey | LPAOSKWRSFAWJA-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |