C16H25ClN2OS — CID 79127344
2-(5-amino-2-chlorophenyl)sulfanyl-N,N-dibutylacetamide (PubChem CID 79127344) has the molecular formula C16H25ClN2OS and a molecular weight of 328.91 g/mol. Its IUPAC name is 2-(5-amino-2-chlorophenyl)sulfanyl-N,N-dibutylacetamide.
| Compound Name | 2-(5-amino-2-chlorophenyl)sulfanyl-N,N-dibutylacetamide |
|---|---|
| PubChem CID | 79127344 |
| Molecular Formula | C16H25ClN2OS |
| Molecular Weight | 328.91 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | 2-(5-amino-2-chlorophenyl)sulfanyl-N,N-dibutylacetamide |
| SMILES | CCCCN(CCCC)C(=O)CSc1cc(N)ccc1Cl |
| InChI | InChI=1S/C16H25ClN2OS/c1-3-5-9-19(10-6-4-2)16(20)12-21-15-11-13(18)7-8-14(15)17/h7-8,11H,3-6,9-10,12,18H2,1-2H3 |
| InChIKey | NHOHUCSRNQYBQW-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.91 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|