C14H18ClNO2S — CID 79133282
4-chloro-3-(1,4-dioxaspiro[4.4]nonan-3-ylmethylsulfanyl)aniline (PubChem CID 79133282) has the molecular formula C14H18ClNO2S and a molecular weight of 299.82 g/mol. Its IUPAC name is 4-chloro-3-(1,4-dioxaspiro[4.4]nonan-3-ylmethylsulfanyl)aniline.
| Compound Name | 4-chloro-3-(1,4-dioxaspiro[4.4]nonan-3-ylmethylsulfanyl)aniline |
|---|---|
| PubChem CID | 79133282 |
| Molecular Formula | C14H18ClNO2S |
| Molecular Weight | 299.82 g/mol |
| Exact Mass | 299.07 |
| IUPAC Name | 4-chloro-3-(1,4-dioxaspiro[4.4]nonan-3-ylmethylsulfanyl)aniline |
| SMILES | Nc1ccc(Cl)c(SCC2COC3(CCCC3)O2)c1 |
| InChI | InChI=1S/C14H18ClNO2S/c15-12-4-3-10(16)7-13(12)19-9-11-8-17-14(18-11)5-1-2-6-14/h3-4,7,11H,1-2,5-6,8-9,16H2 |
| InChIKey | XFUXPSIBADJTHN-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.82 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|