C11H15Br2NO3 — CID 79134897
[4-(aminomethyl)oxan-4-yl]-(4,5-dibromofuran-2-yl)methanol (PubChem CID 79134897) has the molecular formula C11H15Br2NO3 and a molecular weight of 369.05 g/mol. Its IUPAC name is [4-(aminomethyl)oxan-4-yl]-(4,5-dibromofuran-2-yl)methanol.
| Compound Name | [4-(aminomethyl)oxan-4-yl]-(4,5-dibromofuran-2-yl)methanol |
|---|---|
| PubChem CID | 79134897 |
| Molecular Formula | C11H15Br2NO3 |
| Molecular Weight | 369.05 g/mol |
| Exact Mass | 366.94 |
| IUPAC Name | [4-(aminomethyl)oxan-4-yl]-(4,5-dibromofuran-2-yl)methanol |
| SMILES | NCC1(C(O)c2cc(Br)c(Br)o2)CCOCC1 |
| InChI | InChI=1S/C11H15Br2NO3/c12-7-5-8(17-10(7)13)9(15)11(6-14)1-3-16-4-2-11/h5,9,15H,1-4,6,14H2 |
| InChIKey | CZLGTCNCDSZAII-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 68.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.05 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |