C20H20Cl2N2O3 — CID 7913833
[(1S)-2-oxocyclohexyl] (E)-3-[5-chloro-1-[(2-chlorophenyl)methyl]-3-methylpyrazol-4-yl]prop-2-enoate (PubChem CID 7913833) has the molecular formula C20H20Cl2N2O3 and a molecular weight of 407.30 g/mol. Its IUPAC name is [(1S)-2-oxocyclohexyl] (E)-3-[5-chloro-1-[(2-chlorophenyl)methyl]-3-methylpyrazol-4-yl]prop-2-enoate.
| Compound Name | [(1S)-2-oxocyclohexyl] (E)-3-[5-chloro-1-[(2-chlorophenyl)methyl]-3-methylpyrazol-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 7913833 |
| Molecular Formula | C20H20Cl2N2O3 |
| Molecular Weight | 407.30 g/mol |
| Exact Mass | 406.09 |
| IUPAC Name | [(1S)-2-oxocyclohexyl] (E)-3-[5-chloro-1-[(2-chlorophenyl)methyl]-3-methylpyrazol-4-yl]prop-2-enoate |
| SMILES | Cc1nn(Cc2ccccc2Cl)c(Cl)c1/C=C/C(=O)O[C@H]1CCCCC1=O |
| InChI | InChI=1S/C20H20Cl2N2O3/c1-13-15(10-11-19(26)27-18-9-5-4-8-17(18)25)20(22)24(23-13)12-14-6-2-3-7-16(14)21/h2-3,6-7,10-11,18H,4-5,8-9,12H2,1H3/b11-10+/t18-/m0/s1 |
| InChIKey | DQXMVAYRNGCJHA-ZGKFYVQTSA-N |
| XLogP | 4.61 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.30 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|