C13H19NO2 — CID 79138768
1-[4-(aminomethyl)-2,3-dihydrochromen-4-yl]propan-1-ol (PubChem CID 79138768) has the molecular formula C13H19NO2 and a molecular weight of 221.30 g/mol. Its IUPAC name is 1-[4-(aminomethyl)-2,3-dihydrochromen-4-yl]propan-1-ol.
| Compound Name | 1-[4-(aminomethyl)-2,3-dihydrochromen-4-yl]propan-1-ol |
|---|---|
| PubChem CID | 79138768 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | 1-[4-(aminomethyl)-2,3-dihydrochromen-4-yl]propan-1-ol |
| SMILES | CCC(O)C1(CN)CCOc2ccccc21 |
| InChI | InChI=1S/C13H19NO2/c1-2-12(15)13(9-14)7-8-16-11-6-4-3-5-10(11)13/h3-6,12,15H,2,7-9,14H2,1H3 |
| InChIKey | USUBLQSCMGCYAM-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |