C10H10FNO2S — CID 79140636
2-[(4-amino-3-fluorophenyl)sulfanylmethyl]prop-2-enoic acid (PubChem CID 79140636) has the molecular formula C10H10FNO2S and a molecular weight of 227.26 g/mol. Its IUPAC name is 2-[(4-amino-3-fluorophenyl)sulfanylmethyl]prop-2-enoic acid.
| Compound Name | 2-[(4-amino-3-fluorophenyl)sulfanylmethyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 79140636 |
| Molecular Formula | C10H10FNO2S |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.04 |
| IUPAC Name | 2-[(4-amino-3-fluorophenyl)sulfanylmethyl]prop-2-enoic acid |
| SMILES | C=C(CSc1ccc(N)c(F)c1)C(=O)O |
| InChI | InChI=1S/C10H10FNO2S/c1-6(10(13)14)5-15-7-2-3-9(12)8(11)4-7/h2-4H,1,5,12H2,(H,13,14) |
| InChIKey | GKBMHCKDNDPSGQ-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|