C11H12FNO2S — CID 79141091
4-(4-amino-3-fluorophenyl)sulfanyl-2-methylbut-2-enoic acid (PubChem CID 79141091) has the molecular formula C11H12FNO2S and a molecular weight of 241.29 g/mol. Its IUPAC name is 4-(4-amino-3-fluorophenyl)sulfanyl-2-methylbut-2-enoic acid.
| Compound Name | 4-(4-amino-3-fluorophenyl)sulfanyl-2-methylbut-2-enoic acid |
|---|---|
| PubChem CID | 79141091 |
| Molecular Formula | C11H12FNO2S |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.06 |
| IUPAC Name | 4-(4-amino-3-fluorophenyl)sulfanyl-2-methylbut-2-enoic acid |
| SMILES | CC(=CCSc1ccc(N)c(F)c1)C(=O)O |
| InChI | InChI=1S/C11H12FNO2S/c1-7(11(14)15)4-5-16-8-2-3-10(13)9(12)6-8/h2-4,6H,5,13H2,1H3,(H,14,15) |
| InChIKey | NNWMXDAENFDYDX-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|