C10H21N3O — CID 79153657
3-[[2-(aminomethyl)cyclopentyl]methyl]-1,1-dimethylurea (PubChem CID 79153657) has the molecular formula C10H21N3O and a molecular weight of 199.30 g/mol. Its IUPAC name is 3-[[2-(aminomethyl)cyclopentyl]methyl]-1,1-dimethylurea.
| Compound Name | 3-[[2-(aminomethyl)cyclopentyl]methyl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 79153657 |
| Molecular Formula | C10H21N3O |
| Molecular Weight | 199.30 g/mol |
| Exact Mass | 199.17 |
| IUPAC Name | 3-[[2-(aminomethyl)cyclopentyl]methyl]-1,1-dimethylurea |
| SMILES | CN(C)C(=O)NCC1CCCC1CN |
| InChI | InChI=1S/C10H21N3O/c1-13(2)10(14)12-7-9-5-3-4-8(9)6-11/h8-9H,3-7,11H2,1-2H3,(H,12,14) |
| InChIKey | ISCYUJBBGLAWFV-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.30 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |