C11H10BrNO3S — CID 79153908
4-(bromomethyl)-5-(4-methylsulfonylphenyl)-1,3-oxazole (PubChem CID 79153908) has the molecular formula C11H10BrNO3S and a molecular weight of 316.18 g/mol. Its IUPAC name is 4-(bromomethyl)-5-(4-methylsulfonylphenyl)-1,3-oxazole.
| Compound Name | 4-(bromomethyl)-5-(4-methylsulfonylphenyl)-1,3-oxazole |
|---|---|
| PubChem CID | 79153908 |
| Molecular Formula | C11H10BrNO3S |
| Molecular Weight | 316.18 g/mol |
| Exact Mass | 314.96 |
| IUPAC Name | 4-(bromomethyl)-5-(4-methylsulfonylphenyl)-1,3-oxazole |
| SMILES | CS(=O)(=O)c1ccc(-c2ocnc2CBr)cc1 |
| InChI | InChI=1S/C11H10BrNO3S/c1-17(14,15)9-4-2-8(3-5-9)11-10(6-12)13-7-16-11/h2-5,7H,6H2,1H3 |
| InChIKey | XBWCCTVYKIDGEE-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 60.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.18 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|