C13H14BrNO — CID 79153466
4-(bromomethyl)-5-(4-propan-2-ylphenyl)-1,3-oxazole (PubChem CID 79153466) has the molecular formula C13H14BrNO and a molecular weight of 280.17 g/mol. Its IUPAC name is 4-(bromomethyl)-5-(4-propan-2-ylphenyl)-1,3-oxazole.
| Compound Name | 4-(bromomethyl)-5-(4-propan-2-ylphenyl)-1,3-oxazole |
|---|---|
| PubChem CID | 79153466 |
| Molecular Formula | C13H14BrNO |
| Molecular Weight | 280.17 g/mol |
| Exact Mass | 279.03 |
| IUPAC Name | 4-(bromomethyl)-5-(4-propan-2-ylphenyl)-1,3-oxazole |
| SMILES | CC(C)c1ccc(-c2ocnc2CBr)cc1 |
| InChI | InChI=1S/C13H14BrNO/c1-9(2)10-3-5-11(6-4-10)13-12(7-14)15-8-16-13/h3-6,8-9H,7H2,1-2H3 |
| InChIKey | QAELKMWAYLQLGR-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.17 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|