C10H5BrF3NO — CID 79757737
4-(bromomethyl)-5-(2,3,4-trifluorophenyl)-1,3-oxazole (PubChem CID 79757737) has the molecular formula C10H5BrF3NO and a molecular weight of 292.05 g/mol. Its IUPAC name is 4-(bromomethyl)-5-(2,3,4-trifluorophenyl)-1,3-oxazole.
| Compound Name | 4-(bromomethyl)-5-(2,3,4-trifluorophenyl)-1,3-oxazole |
|---|---|
| PubChem CID | 79757737 |
| Molecular Formula | C10H5BrF3NO |
| Molecular Weight | 292.05 g/mol |
| Exact Mass | 290.95 |
| IUPAC Name | 4-(bromomethyl)-5-(2,3,4-trifluorophenyl)-1,3-oxazole |
| SMILES | Fc1ccc(-c2ocnc2CBr)c(F)c1F |
| InChI | InChI=1S/C10H5BrF3NO/c11-3-7-10(16-4-15-7)5-1-2-6(12)9(14)8(5)13/h1-2,4H,3H2 |
| InChIKey | URPVNDZQAPMRSD-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.05 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|