C8H4Br3NOS — CID 107967352
4-(bromomethyl)-5-(2,5-dibromothiophen-3-yl)-1,3-oxazole (PubChem CID 107967352) has the molecular formula C8H4Br3NOS and a molecular weight of 401.91 g/mol. Its IUPAC name is 4-(bromomethyl)-5-(2,5-dibromothiophen-3-yl)-1,3-oxazole.
| Compound Name | 4-(bromomethyl)-5-(2,5-dibromothiophen-3-yl)-1,3-oxazole |
|---|---|
| PubChem CID | 107967352 |
| Molecular Formula | C8H4Br3NOS |
| Molecular Weight | 401.91 g/mol |
| Exact Mass | 398.76 |
| IUPAC Name | 4-(bromomethyl)-5-(2,5-dibromothiophen-3-yl)-1,3-oxazole |
| SMILES | BrCc1ncoc1-c1cc(Br)sc1Br |
| InChI | InChI=1S/C8H4Br3NOS/c9-2-5-7(13-3-12-5)4-1-6(10)14-8(4)11/h1,3H,2H2 |
| InChIKey | LFZRVALDWSXPOT-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.91 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|