C12H8BrNOS — CID 79153243
5-(1-benzothiophen-3-yl)-4-(bromomethyl)-1,3-oxazole (PubChem CID 79153243) has the molecular formula C12H8BrNOS and a molecular weight of 294.17 g/mol. Its IUPAC name is 5-(1-benzothiophen-3-yl)-4-(bromomethyl)-1,3-oxazole.
| Compound Name | 5-(1-benzothiophen-3-yl)-4-(bromomethyl)-1,3-oxazole |
|---|---|
| PubChem CID | 79153243 |
| Molecular Formula | C12H8BrNOS |
| Molecular Weight | 294.17 g/mol |
| Exact Mass | 292.95 |
| IUPAC Name | 5-(1-benzothiophen-3-yl)-4-(bromomethyl)-1,3-oxazole |
| SMILES | BrCc1ncoc1-c1csc2ccccc12 |
| InChI | InChI=1S/C12H8BrNOS/c13-5-10-12(15-7-14-10)9-6-16-11-4-2-1-3-8(9)11/h1-4,6-7H,5H2 |
| InChIKey | FIRZIQRCQHEVGF-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.17 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|