C10H6F3NO2 — CID 79757541
[5-(2,3,4-trifluorophenyl)-1,3-oxazol-4-yl]methanol (PubChem CID 79757541) has the molecular formula C10H6F3NO2 and a molecular weight of 229.16 g/mol. Its IUPAC name is [5-(2,3,4-trifluorophenyl)-1,3-oxazol-4-yl]methanol.
| Compound Name | [5-(2,3,4-trifluorophenyl)-1,3-oxazol-4-yl]methanol |
|---|---|
| PubChem CID | 79757541 |
| Molecular Formula | C10H6F3NO2 |
| Molecular Weight | 229.16 g/mol |
| Exact Mass | 229.04 |
| IUPAC Name | [5-(2,3,4-trifluorophenyl)-1,3-oxazol-4-yl]methanol |
| SMILES | OCc1ncoc1-c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C10H6F3NO2/c11-6-2-1-5(8(12)9(6)13)10-7(3-15)14-4-16-10/h1-2,4,15H,3H2 |
| InChIKey | SZLLKEIOTNTOQS-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.16 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|