C11H8ClF2NO — CID 82818711
4-(chloromethyl)-5-(2,6-difluoro-3-methylphenyl)-1,3-oxazole (PubChem CID 82818711) has the molecular formula C11H8ClF2NO and a molecular weight of 243.64 g/mol. Its IUPAC name is 4-(chloromethyl)-5-(2,6-difluoro-3-methylphenyl)-1,3-oxazole.
| Compound Name | 4-(chloromethyl)-5-(2,6-difluoro-3-methylphenyl)-1,3-oxazole |
|---|---|
| PubChem CID | 82818711 |
| Molecular Formula | C11H8ClF2NO |
| Molecular Weight | 243.64 g/mol |
| Exact Mass | 243.03 |
| IUPAC Name | 4-(chloromethyl)-5-(2,6-difluoro-3-methylphenyl)-1,3-oxazole |
| SMILES | Cc1ccc(F)c(-c2ocnc2CCl)c1F |
| InChI | InChI=1S/C11H8ClF2NO/c1-6-2-3-7(13)9(10(6)14)11-8(4-12)15-5-16-11/h2-3,5H,4H2,1H3 |
| InChIKey | PVZLYWLTBRMRRE-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.64 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|