C11H10BrNO2 — CID 107984323
[5-(2-bromo-3-methylphenyl)-1,3-oxazol-4-yl]methanol (PubChem CID 107984323) has the molecular formula C11H10BrNO2 and a molecular weight of 268.11 g/mol. Its IUPAC name is [5-(2-bromo-3-methylphenyl)-1,3-oxazol-4-yl]methanol.
| Compound Name | [5-(2-bromo-3-methylphenyl)-1,3-oxazol-4-yl]methanol |
|---|---|
| PubChem CID | 107984323 |
| Molecular Formula | C11H10BrNO2 |
| Molecular Weight | 268.11 g/mol |
| Exact Mass | 266.99 |
| IUPAC Name | [5-(2-bromo-3-methylphenyl)-1,3-oxazol-4-yl]methanol |
| SMILES | Cc1cccc(-c2ocnc2CO)c1Br |
| InChI | InChI=1S/C11H10BrNO2/c1-7-3-2-4-8(10(7)12)11-9(5-14)13-6-15-11/h2-4,6,14H,5H2,1H3 |
| InChIKey | UXOAFXARCPMPNV-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.11 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |