C12H9NO3 — CID 79145508
[5-(1-benzofuran-2-yl)-1,3-oxazol-4-yl]methanol (PubChem CID 79145508) has the molecular formula C12H9NO3 and a molecular weight of 215.21 g/mol. Its IUPAC name is [5-(1-benzofuran-2-yl)-1,3-oxazol-4-yl]methanol.
| Compound Name | [5-(1-benzofuran-2-yl)-1,3-oxazol-4-yl]methanol |
|---|---|
| PubChem CID | 79145508 |
| Molecular Formula | C12H9NO3 |
| Molecular Weight | 215.21 g/mol |
| Exact Mass | 215.06 |
| IUPAC Name | [5-(1-benzofuran-2-yl)-1,3-oxazol-4-yl]methanol |
| SMILES | OCc1ncoc1-c1cc2ccccc2o1 |
| InChI | InChI=1S/C12H9NO3/c14-6-9-12(15-7-13-9)11-5-8-3-1-2-4-10(8)16-11/h1-5,7,14H,6H2 |
| InChIKey | PBFAMVDNFTYTID-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 59.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.21 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |