C9H18N4O — CID 79154110
2-carbamimidoyl-N,N-dimethylpiperidine-1-carboxamide (PubChem CID 79154110) has the molecular formula C9H18N4O and a molecular weight of 198.27 g/mol. Its IUPAC name is 2-carbamimidoyl-N,N-dimethylpiperidine-1-carboxamide.
| Compound Name | 2-carbamimidoyl-N,N-dimethylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 79154110 |
| Molecular Formula | C9H18N4O |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.15 |
| IUPAC Name | 2-carbamimidoyl-N,N-dimethylpiperidine-1-carboxamide |
| SMILES | [H]/N=C(\N)C1CCCCN1C(=O)N(C)C |
| InChI | InChI=1S/C9H18N4O/c1-12(2)9(14)13-6-4-3-5-7(13)8(10)11/h7H,3-6H2,1-2H3,(H3,10,11) |
| InChIKey | SNLQHZJKMUSJNI-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 73.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|