C8H18N4O2 — CID 79154540
3-(1-amino-1-hydroxyimino-2-methylbutan-2-yl)-1,1-dimethylurea (PubChem CID 79154540) has the molecular formula C8H18N4O2 and a molecular weight of 202.26 g/mol. Its IUPAC name is 3-(1-amino-1-hydroxyimino-2-methylbutan-2-yl)-1,1-dimethylurea.
| Compound Name | 3-(1-amino-1-hydroxyimino-2-methylbutan-2-yl)-1,1-dimethylurea |
|---|---|
| PubChem CID | 79154540 |
| Molecular Formula | C8H18N4O2 |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.14 |
| IUPAC Name | 3-(1-amino-1-hydroxyimino-2-methylbutan-2-yl)-1,1-dimethylurea |
| SMILES | CCC(C)(NC(=O)N(C)C)C(N)=NO |
| InChI | InChI=1S/C8H18N4O2/c1-5-8(2,6(9)11-14)10-7(13)12(3)4/h14H,5H2,1-4H3,(H2,9,11)(H,10,13) |
| InChIKey | FAKFCBQWKXLURX-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 90.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|