About 3-(1-amino-1-hydroxyimino-2-methylbutan-2-yl)-1,1-dimethylurea
3-(1-amino-1-hydroxyimino-2-methylbutan-2-yl)-1,1-dimethylurea (PubChem CID 79154540) has the molecular formula C8H18N4O2
and a molecular weight of 202.26 g/mol. Its IUPAC name is 3-(1-amino-1-hydroxyimino-2-methylbutan-2-yl)-1,1-dimethylurea.
Molecular Properties
| Compound Name | 3-(1-amino-1-hydroxyimino-2-methylbutan-2-yl)-1,1-dimethylurea |
| PubChem CID | 79154540 |
| Molecular Formula | C8H18N4O2 |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.14 |
| IUPAC Name | 3-(1-amino-1-hydroxyimino-2-methylbutan-2-yl)-1,1-dimethylurea |
| SMILES | CCC(C)(NC(=O)N(C)C)C(N)=NO |
| InChI | InChI=1S/C8H18N4O2/c1-5-8(2,6(9)11-14)10-7(13)12(3)4/h14H,5H2,1-4H3,(H2,9,11)(H,10,13) |
| InChIKey | FAKFCBQWKXLURX-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 90.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-(1-amino-1-hydroxyimino-2-methylbutan-2-yl)-1,1-dimethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1-amino-1-hydroxyimino-2-methylbutan-2-yl)-1,1-dimethylurea?
The IUPAC name of 3-(1-amino-1-hydroxyimino-2-methylbutan-2-yl)-1,1-dimethylurea (CID 79154540) is 3-(1-amino-1-hydroxyimino-2-methylbutan-2-yl)-1,1-dimethylurea.
What is the SMILES notation for 3-(1-amino-1-hydroxyimino-2-methylbutan-2-yl)-1,1-dimethylurea?
The canonical SMILES for 3-(1-amino-1-hydroxyimino-2-methylbutan-2-yl)-1,1-dimethylurea is CCC(C)(NC(=O)N(C)C)C(N)=NO.
What is the InChIKey of 3-(1-amino-1-hydroxyimino-2-methylbutan-2-yl)-1,1-dimethylurea?
The InChIKey is FAKFCBQWKXLURX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18N4O2/c1-5-8(2,6(9)11-14)10-7(13)12(3)4/h14H,5H2,1-4H3,(H2,9,11)(H,10,13).
What are the key properties of 3-(1-amino-1-hydroxyimino-2-methylbutan-2-yl)-1,1-dimethylurea?
3-(1-amino-1-hydroxyimino-2-methylbutan-2-yl)-1,1-dimethylurea has a molecular weight of 202.26 g/mol, XLogP of 0.17, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1-amino-1-hydroxyimino-2-methylbutan-2-yl)-1,1-dimethylurea is sourced from PubChem (CID 79154540), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).