C9H16N6O2 — CID 112735696
N-(1-amino-1-hydroxyimino-2-methylbutan-2-yl)-1-methyltriazole-4-carboxamide (PubChem CID 112735696) has the molecular formula C9H16N6O2 and a molecular weight of 240.27 g/mol. Its IUPAC name is N-(1-amino-1-hydroxyimino-2-methylbutan-2-yl)-1-methyltriazole-4-carboxamide.
| Compound Name | N-(1-amino-1-hydroxyimino-2-methylbutan-2-yl)-1-methyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 112735696 |
| Molecular Formula | C9H16N6O2 |
| Molecular Weight | 240.27 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | N-(1-amino-1-hydroxyimino-2-methylbutan-2-yl)-1-methyltriazole-4-carboxamide |
| SMILES | CCC(C)(NC(=O)c1cn(C)nn1)C(N)=NO |
| InChI | InChI=1S/C9H16N6O2/c1-4-9(2,8(10)13-17)11-7(16)6-5-15(3)14-12-6/h5,17H,4H2,1-3H3,(H2,10,13)(H,11,16) |
| InChIKey | ACVUBDNMGURQOE-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 118.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.27 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|