C13H25N3O — CID 79159344
3-methyl-N-(2-methylpiperidin-3-yl)piperidine-1-carboxamide (PubChem CID 79159344) has the molecular formula C13H25N3O and a molecular weight of 239.36 g/mol. Its IUPAC name is 3-methyl-N-(2-methylpiperidin-3-yl)piperidine-1-carboxamide.
| Compound Name | 3-methyl-N-(2-methylpiperidin-3-yl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 79159344 |
| Molecular Formula | C13H25N3O |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.20 |
| IUPAC Name | 3-methyl-N-(2-methylpiperidin-3-yl)piperidine-1-carboxamide |
| SMILES | CC1CCCN(C(=O)NC2CCCNC2C)C1 |
| InChI | InChI=1S/C13H25N3O/c1-10-5-4-8-16(9-10)13(17)15-12-6-3-7-14-11(12)2/h10-12,14H,3-9H2,1-2H3,(H,15,17) |
| InChIKey | UBHHIXGVKWCLLH-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |