C11H13N3O5 — CID 79172604
4-[(4-methyl-5-nitro-2-pyridinyl)amino]oxolane-3-carboxylic acid (PubChem CID 79172604) has the molecular formula C11H13N3O5 and a molecular weight of 267.24 g/mol. Its IUPAC name is 4-[(4-methyl-5-nitro-2-pyridinyl)amino]oxolane-3-carboxylic acid.
| Compound Name | 4-[(4-methyl-5-nitro-2-pyridinyl)amino]oxolane-3-carboxylic acid |
|---|---|
| PubChem CID | 79172604 |
| Molecular Formula | C11H13N3O5 |
| Molecular Weight | 267.24 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | 4-[(4-methyl-5-nitro-2-pyridinyl)amino]oxolane-3-carboxylic acid |
| SMILES | Cc1cc(NC2COCC2C(=O)O)ncc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H13N3O5/c1-6-2-10(12-3-9(6)14(17)18)13-8-5-19-4-7(8)11(15)16/h2-3,7-8H,4-5H2,1H3,(H,12,13)(H,15,16) |
| InChIKey | HLMFDOHIIOKTGS-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 114.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.24 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|