C9H10N4O5 — CID 66239913
4-[(5-nitropyrimidin-2-yl)amino]oxolane-3-carboxylic acid (PubChem CID 66239913) has the molecular formula C9H10N4O5 and a molecular weight of 254.20 g/mol. Its IUPAC name is 4-[(5-nitropyrimidin-2-yl)amino]oxolane-3-carboxylic acid.
| Compound Name | 4-[(5-nitropyrimidin-2-yl)amino]oxolane-3-carboxylic acid |
|---|---|
| PubChem CID | 66239913 |
| Molecular Formula | C9H10N4O5 |
| Molecular Weight | 254.20 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | 4-[(5-nitropyrimidin-2-yl)amino]oxolane-3-carboxylic acid |
| SMILES | O=C(O)C1COCC1Nc1ncc([N+](=O)[O-])cn1 |
| InChI | InChI=1S/C9H10N4O5/c14-8(15)6-3-18-4-7(6)12-9-10-1-5(2-11-9)13(16)17/h1-2,6-7H,3-4H2,(H,14,15)(H,10,11,12) |
| InChIKey | HLOSIQOPHGAWRI-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 127.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.20 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|