C12H20N4O3 — CID 79183086
(4-ethylmorpholin-2-yl)methyl 2-(4-aminopyrazol-1-yl)acetate (PubChem CID 79183086) has the molecular formula C12H20N4O3 and a molecular weight of 268.32 g/mol. Its IUPAC name is (4-ethylmorpholin-2-yl)methyl 2-(4-aminopyrazol-1-yl)acetate.
| Compound Name | (4-ethylmorpholin-2-yl)methyl 2-(4-aminopyrazol-1-yl)acetate |
|---|---|
| PubChem CID | 79183086 |
| Molecular Formula | C12H20N4O3 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | (4-ethylmorpholin-2-yl)methyl 2-(4-aminopyrazol-1-yl)acetate |
| SMILES | CCN1CCOC(COC(=O)Cn2cc(N)cn2)C1 |
| InChI | InChI=1S/C12H20N4O3/c1-2-15-3-4-18-11(7-15)9-19-12(17)8-16-6-10(13)5-14-16/h5-6,11H,2-4,7-9,13H2,1H3 |
| InChIKey | KIVBMYCOCRKQSV-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |