C13H17FN2O3S — CID 79186833
3-(3,4-dimethylpyrrolidine-1-carbonyl)-5-fluorobenzenesulfonamide (PubChem CID 79186833) has the molecular formula C13H17FN2O3S and a molecular weight of 300.36 g/mol. Its IUPAC name is 3-(3,4-dimethylpyrrolidine-1-carbonyl)-5-fluorobenzenesulfonamide.
| Compound Name | 3-(3,4-dimethylpyrrolidine-1-carbonyl)-5-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 79186833 |
| Molecular Formula | C13H17FN2O3S |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | 3-(3,4-dimethylpyrrolidine-1-carbonyl)-5-fluorobenzenesulfonamide |
| SMILES | CC1CN(C(=O)c2cc(F)cc(S(N)(=O)=O)c2)CC1C |
| InChI | InChI=1S/C13H17FN2O3S/c1-8-6-16(7-9(8)2)13(17)10-3-11(14)5-12(4-10)20(15,18)19/h3-5,8-9H,6-7H2,1-2H3,(H2,15,18,19) |
| InChIKey | RTSFHIPAZYNJRI-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |