C14H17BrF3N — CID 79190197
1-[4-bromo-2-(trifluoromethyl)phenyl]-N-ethyl-3-methylbut-2-en-1-amine (PubChem CID 79190197) has the molecular formula C14H17BrF3N and a molecular weight of 336.20 g/mol. Its IUPAC name is 1-[4-bromo-2-(trifluoromethyl)phenyl]-N-ethyl-3-methylbut-2-en-1-amine.
| Compound Name | 1-[4-bromo-2-(trifluoromethyl)phenyl]-N-ethyl-3-methylbut-2-en-1-amine |
|---|---|
| PubChem CID | 79190197 |
| Molecular Formula | C14H17BrF3N |
| Molecular Weight | 336.20 g/mol |
| Exact Mass | 335.05 |
| IUPAC Name | 1-[4-bromo-2-(trifluoromethyl)phenyl]-N-ethyl-3-methylbut-2-en-1-amine |
| SMILES | CCNC(C=C(C)C)c1ccc(Br)cc1C(F)(F)F |
| InChI | InChI=1S/C14H17BrF3N/c1-4-19-13(7-9(2)3)11-6-5-10(15)8-12(11)14(16,17)18/h5-8,13,19H,4H2,1-3H3 |
| InChIKey | SWKBGDWYGFMCOI-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.20 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|