C14H12Br2F3NO — CID 107332730
N-[(5-bromofuran-2-yl)-[4-bromo-2-(trifluoromethyl)phenyl]methyl]ethanamine (PubChem CID 107332730) has the molecular formula C14H12Br2F3NO and a molecular weight of 427.06 g/mol. Its IUPAC name is N-[(5-bromofuran-2-yl)-[4-bromo-2-(trifluoromethyl)phenyl]methyl]ethanamine.
| Compound Name | N-[(5-bromofuran-2-yl)-[4-bromo-2-(trifluoromethyl)phenyl]methyl]ethanamine |
|---|---|
| PubChem CID | 107332730 |
| Molecular Formula | C14H12Br2F3NO |
| Molecular Weight | 427.06 g/mol |
| Exact Mass | 424.92 |
| IUPAC Name | N-[(5-bromofuran-2-yl)-[4-bromo-2-(trifluoromethyl)phenyl]methyl]ethanamine |
| SMILES | CCNC(c1ccc(Br)o1)c1ccc(Br)cc1C(F)(F)F |
| InChI | InChI=1S/C14H12Br2F3NO/c1-2-20-13(11-5-6-12(16)21-11)9-4-3-8(15)7-10(9)14(17,18)19/h3-7,13,20H,2H2,1H3 |
| InChIKey | SDTAFHOMPJRBLG-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.06 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |