C16H15F2NOS — CID 79206020
4-(difluoromethoxy)-N-(2,3-dihydro-1-benzothiophen-3-ylmethyl)aniline (PubChem CID 79206020) has the molecular formula C16H15F2NOS and a molecular weight of 307.37 g/mol. Its IUPAC name is 4-(difluoromethoxy)-N-(2,3-dihydro-1-benzothiophen-3-ylmethyl)aniline.
| Compound Name | 4-(difluoromethoxy)-N-(2,3-dihydro-1-benzothiophen-3-ylmethyl)aniline |
|---|---|
| PubChem CID | 79206020 |
| Molecular Formula | C16H15F2NOS |
| Molecular Weight | 307.37 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | 4-(difluoromethoxy)-N-(2,3-dihydro-1-benzothiophen-3-ylmethyl)aniline |
| SMILES | FC(F)Oc1ccc(NCC2CSc3ccccc32)cc1 |
| InChI | InChI=1S/C16H15F2NOS/c17-16(18)20-13-7-5-12(6-8-13)19-9-11-10-21-15-4-2-1-3-14(11)15/h1-8,11,16,19H,9-10H2 |
| InChIKey | OCKRXVVKZLNCFD-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.37 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|